C22H36IN5O3 — CID 110039212
2-[[N'-[(4-methoxyphenyl)methyl]-N-[1-(2-methylpropanoyl)piperidin-4-yl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110039212) has the molecular formula C22H36IN5O3 and a molecular weight of 545.47 g/mol. Its IUPAC name is 2-[[N'-[(4-methoxyphenyl)methyl]-N-[1-(2-methylpropanoyl)piperidin-4-yl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[(4-methoxyphenyl)methyl]-N-[1-(2-methylpropanoyl)piperidin-4-yl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110039212 |
| Molecular Formula | C22H36IN5O3 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 2-[[N'-[(4-methoxyphenyl)methyl]-N-[1-(2-methylpropanoyl)piperidin-4-yl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)N(C)C)NC2CCN(C(=O)C(C)C)CC2)cc1.I |
| InChI | InChI=1S/C22H35N5O3.HI/c1-16(2)21(29)27-12-10-18(11-13-27)25-22(24-15-20(28)26(3)4)23-14-17-6-8-19(30-5)9-7-17;/h6-9,16,18H,10-15H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | WAGXARHPYDRYHP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|