C24H37N5O3 — CID 110047310
2-[[N-[1-(cyclohexanecarbonyl)pyrrolidin-3-yl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110047310) has the molecular formula C24H37N5O3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-[[N-[1-(cyclohexanecarbonyl)pyrrolidin-3-yl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-[1-(cyclohexanecarbonyl)pyrrolidin-3-yl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110047310 |
| Molecular Formula | C24H37N5O3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 2-[[N-[1-(cyclohexanecarbonyl)pyrrolidin-3-yl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)N(C)C)NC2CCN(C(=O)C3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C24H37N5O3/c1-28(2)22(30)16-26-24(25-15-18-9-11-21(32-3)12-10-18)27-20-13-14-29(17-20)23(31)19-7-5-4-6-8-19/h9-12,19-20H,4-8,13-17H2,1-3H3,(H2,25,26,27) |
| InChIKey | PCEDBDGTPGDWLQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|