C19H26F3IN6O — CID 111863148
N,N-dimethyl-2-[[N-(3-pyrazol-1-ylpropyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111863148) has the molecular formula C19H26F3IN6O and a molecular weight of 538.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(3-pyrazol-1-ylpropyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N-(3-pyrazol-1-ylpropyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111863148 |
| Molecular Formula | C19H26F3IN6O |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | N,N-dimethyl-2-[[N-(3-pyrazol-1-ylpropyl)-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1cccc(C(F)(F)F)c1)NCCCn1cccn1.I |
| InChI | InChI=1S/C19H25F3N6O.HI/c1-27(2)17(29)14-25-18(23-8-4-10-28-11-5-9-26-28)24-13-15-6-3-7-16(12-15)19(20,21)22;/h3,5-7,9,11-12H,4,8,10,13-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | LDSSUIFKEMKSTO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|