C23H34F3N5 — CID 111985425
N-ethyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N'-[3-(1H-indol-3-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111985425) has the molecular formula C23H34F3N5 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-ethyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N'-[3-(1H-indol-3-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N'-[3-(1H-indol-3-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111985425 |
| Molecular Formula | C23H34F3N5 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | N-ethyl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N'-[3-(1H-indol-3-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1c[nH]c2ccccc12)N1CCC(CN(CC)CC(F)(F)F)C1 |
| InChI | InChI=1S/C23H34F3N5/c1-3-27-22(28-12-7-8-19-14-29-21-10-6-5-9-20(19)21)31-13-11-18(16-31)15-30(4-2)17-23(24,25)26/h5-6,9-10,14,18,29H,3-4,7-8,11-13,15-17H2,1-2H3,(H,27,28) |
| InChIKey | QCUHQJZVFHAMJC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|