C23H35N5O2 — CID 111984705
tert-butyl N-[1-[N-ethyl-N'-[3-(1H-indol-3-yl)propyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111984705) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[3-(1H-indol-3-yl)propyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[3-(1H-indol-3-yl)propyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111984705 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[3-(1H-indol-3-yl)propyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CCCc1c[nH]c2ccccc12)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H35N5O2/c1-5-24-21(28-14-12-18(16-28)27-22(29)30-23(2,3)4)25-13-8-9-17-15-26-20-11-7-6-10-19(17)20/h6-7,10-11,15,18,26H,5,8-9,12-14,16H2,1-4H3,(H,24,25)(H,27,29) |
| InChIKey | OLGGBFZDXWVZKN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|