C23H39IN4O4 — CID 111730798
tert-butyl N-[1-[N'-[3-(3,4-dimethoxyphenyl)propyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide (PubChem CID 111730798) has the molecular formula C23H39IN4O4 and a molecular weight of 562.49 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-[3-(3,4-dimethoxyphenyl)propyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[N'-[3-(3,4-dimethoxyphenyl)propyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111730798 |
| Molecular Formula | C23H39IN4O4 |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | tert-butyl N-[1-[N'-[3-(3,4-dimethoxyphenyl)propyl]-N-ethylcarbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCc1ccc(OC)c(OC)c1)N1CCC(NC(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C23H38N4O4.HI/c1-7-24-21(27-14-12-18(16-27)26-22(28)31-23(2,3)4)25-13-8-9-17-10-11-19(29-5)20(15-17)30-6;/h10-11,15,18H,7-9,12-14,16H2,1-6H3,(H,24,25)(H,26,28);1H |
| InChIKey | ZBKOATBPKZIWJM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|