C23H36N4O3 — CID 111730221
tert-butyl N-[1-[N-ethyl-N'-[[1-(2-methoxyphenyl)cyclopropyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730221) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[[1-(2-methoxyphenyl)cyclopropyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[[1-(2-methoxyphenyl)cyclopropyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730221 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[[1-(2-methoxyphenyl)cyclopropyl]methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CC1(c2ccccc2OC)CC1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H36N4O3/c1-6-24-20(27-14-11-17(15-27)26-21(28)30-22(2,3)4)25-16-23(12-13-23)18-9-7-8-10-19(18)29-5/h7-10,17H,6,11-16H2,1-5H3,(H,24,25)(H,26,28) |
| InChIKey | YUJOFFBSIBBCTK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|