C22H33N5O2 — CID 111729045
tert-butyl N-[1-[N-ethyl-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729045) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729045 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\CCc1c[nH]c2ccccc12)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H33N5O2/c1-5-23-20(24-12-10-16-14-25-19-9-7-6-8-18(16)19)27-13-11-17(15-27)26-21(28)29-22(2,3)4/h6-9,14,17,25H,5,10-13,15H2,1-4H3,(H,23,24)(H,26,28) |
| InChIKey | WFOSNUSDEBJFGR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|