C23H39IN4 — CID 109414922
4-benzylidene-N-ethyl-N'-[4-[methyl(propan-2-yl)amino]butyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 109414922) has the molecular formula C23H39IN4 and a molecular weight of 498.50 g/mol. Its IUPAC name is 4-benzylidene-N-ethyl-N'-[4-[methyl(propan-2-yl)amino]butyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzylidene-N-ethyl-N'-[4-[methyl(propan-2-yl)amino]butyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109414922 |
| Molecular Formula | C23H39IN4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 4-benzylidene-N-ethyl-N'-[4-[methyl(propan-2-yl)amino]butyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCN(C)C(C)C)N1CCC(=Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H38N4.HI/c1-5-24-23(25-15-9-10-16-26(4)20(2)3)27-17-13-22(14-18-27)19-21-11-7-6-8-12-21;/h6-8,11-12,19-20H,5,9-10,13-18H2,1-4H3,(H,24,25);1H |
| InChIKey | OBOJJNLSSCNDFS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|