C22H34N4OS — CID 109486984
N'-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-N,2-diethylthiomorpholine-4-carboximidamide (PubChem CID 109486984) has the molecular formula C22H34N4OS and a molecular weight of 402.61 g/mol. Its IUPAC name is N'-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-N,2-diethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-N,2-diethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486984 |
| Molecular Formula | C22H34N4OS |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | N'-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-N,2-diethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCCC(=O)N1CCc2ccccc2C1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C22H34N4OS/c1-3-20-17-26(14-15-28-20)22(23-4-2)24-12-7-10-21(27)25-13-11-18-8-5-6-9-19(18)16-25/h5-6,8-9,20H,3-4,7,10-17H2,1-2H3,(H,23,24) |
| InChIKey | XFTJMCXISFZPDP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|