C18H26N8OS — CID 111207694
N-[2-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111207694) has the molecular formula C18H26N8OS and a molecular weight of 402.53 g/mol. Its IUPAC name is N-[2-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111207694 |
| Molecular Formula | C18H26N8OS |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-[2-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN/C(=N\CCNC(=O)c1scnc1C)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H26N8OS/c1-3-19-17(23-8-7-20-16(27)15-14(2)24-13-28-15)25-9-11-26(12-10-25)18-21-5-4-6-22-18/h4-6,13H,3,7-12H2,1-2H3,(H,19,23)(H,20,27) |
| InChIKey | MFCPFKYNLHETFO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|