C22H30IN5OS — CID 109414366
N-[2-[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 109414366) has the molecular formula C22H30IN5OS and a molecular weight of 539.49 g/mol. Its IUPAC name is N-[2-[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109414366 |
| Molecular Formula | C22H30IN5OS |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | N-[2-[[(4-benzylidenepiperidin-1-yl)-(ethylamino)methylidene]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1scnc1C)N1CCC(=Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H29N5OS.HI/c1-3-23-22(25-12-11-24-21(28)20-17(2)26-16-29-20)27-13-9-19(10-14-27)15-18-7-5-4-6-8-18;/h4-8,15-16H,3,9-14H2,1-2H3,(H,23,25)(H,24,28);1H |
| InChIKey | PPVSSGOLVRTHLJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|