C16H24F3N5 — CID 111739126
N',3,3-trimethyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111739126) has the molecular formula C16H24F3N5 and a molecular weight of 343.40 g/mol. Its IUPAC name is N',3,3-trimethyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N',3,3-trimethyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111739126 |
| Molecular Formula | C16H24F3N5 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N',3,3-trimethyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCNc1ncccc1C(F)(F)F)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C16H24F3N5/c1-15(2)6-10-24(11-15)14(20-3)23-9-8-22-13-12(16(17,18)19)5-4-7-21-13/h4-5,7H,6,8-11H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | IQMPCWQQVTYUBC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|