C15H18F3N5O — CID 110934323
1-(furan-2-ylmethyl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine (PubChem CID 110934323) has the molecular formula C15H18F3N5O and a molecular weight of 341.34 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine.
| Compound Name | 1-(furan-2-ylmethyl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 110934323 |
| Molecular Formula | C15H18F3N5O |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-methyl-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
| SMILES | C/N=C(/NCCNc1ncccc1C(F)(F)F)NCc1ccco1 |
| InChI | InChI=1S/C15H18F3N5O/c1-19-14(23-10-11-4-3-9-24-11)22-8-7-21-13-12(15(16,17)18)5-2-6-20-13/h2-6,9H,7-8,10H2,1H3,(H,20,21)(H2,19,22,23) |
| InChIKey | NFQDFCUFWWOGFA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|