C18H27FN4O — CID 111739446
N-[2-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 111739446) has the molecular formula C18H27FN4O and a molecular weight of 334.44 g/mol. Its IUPAC name is N-[2-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111739446 |
| Molecular Formula | C18H27FN4O |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | N-[2-[[C-(3,3-dimethylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | C/N=C(/NCCNC(=O)Cc1cccc(F)c1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C18H27FN4O/c1-18(2)7-10-23(13-18)17(20-3)22-9-8-21-16(24)12-14-5-4-6-15(19)11-14/h4-6,11H,7-10,12-13H2,1-3H3,(H,20,22)(H,21,24) |
| InChIKey | KRPLEEBALKDTKV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|