C18H24FN3O2 — CID 95932918
(1S,5R)-N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 95932918) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is (1S,5R)-N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1S,5R)-N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 95932918 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (1S,5R)-N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CC1(C)[C@@H]2CN(C(=O)NCCNC(=O)Cc3cccc(F)c3)C[C@@H]21 |
| InChI | InChI=1S/C18H24FN3O2/c1-18(2)14-10-22(11-15(14)18)17(24)21-7-6-20-16(23)9-12-4-3-5-13(19)8-12/h3-5,8,14-15H,6-7,9-11H2,1-2H3,(H,20,23)(H,21,24)/t14-,15+ |
| InChIKey | YORWRDXBOXUVSQ-GASCZTMLSA-N |
| XLogP | 1.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|