C23H33FN4O3 — CID 86875056
4-(azepane-1-carbonyl)-N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]piperidine-1-carboxamide (PubChem CID 86875056) has the molecular formula C23H33FN4O3 and a molecular weight of 432.54 g/mol. Its IUPAC name is 4-(azepane-1-carbonyl)-N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]piperidine-1-carboxamide.
| Compound Name | 4-(azepane-1-carbonyl)-N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86875056 |
| Molecular Formula | C23H33FN4O3 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 4-(azepane-1-carbonyl)-N-[2-[[2-(3-fluorophenyl)acetyl]amino]ethyl]piperidine-1-carboxamide |
| SMILES | O=C(Cc1cccc(F)c1)NCCNC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C23H33FN4O3/c24-20-7-5-6-18(16-20)17-21(29)25-10-11-26-23(31)28-14-8-19(9-15-28)22(30)27-12-3-1-2-4-13-27/h5-7,16,19H,1-4,8-15,17H2,(H,25,29)(H,26,31) |
| InChIKey | UAFZZPZNEGTYBR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|