C13H15F3N4O2S — CID 51089168
2-(4-oxo-1,3-thiazolidin-3-yl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 51089168) has the molecular formula C13H15F3N4O2S and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-(4-oxo-1,3-thiazolidin-3-yl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-(4-oxo-1,3-thiazolidin-3-yl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 51089168 |
| Molecular Formula | C13H15F3N4O2S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(4-oxo-1,3-thiazolidin-3-yl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | O=C(CN1CSCC1=O)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N4O2S/c14-13(15,16)9-2-1-3-18-12(9)19-5-4-17-10(21)6-20-8-23-7-11(20)22/h1-3H,4-8H2,(H,17,21)(H,18,19) |
| InChIKey | OOCSPKKQYPFCMN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|