C21H23F3N4O2 — CID 55934019
1-(2-ethylphenyl)-5-oxo-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-3-carboxamide (PubChem CID 55934019) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-5-oxo-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-ethylphenyl)-5-oxo-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55934019 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-(2-ethylphenyl)-5-oxo-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-3-carboxamide |
| SMILES | CCc1ccccc1N1CC(C(=O)NCCNc2ncccc2C(F)(F)F)CC1=O |
| InChI | InChI=1S/C21H23F3N4O2/c1-2-14-6-3-4-8-17(14)28-13-15(12-18(28)29)20(30)27-11-10-26-19-16(21(22,23)24)7-5-9-25-19/h3-9,15H,2,10-13H2,1H3,(H,25,26)(H,27,30) |
| InChIKey | ZNKBOGQVVPDXSL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|