C22H33N3O2 — CID 55335688
1-(2-ethylphenyl)-N-(2-methyl-2-piperidin-1-ylpropyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55335688) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-N-(2-methyl-2-piperidin-1-ylpropyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-ethylphenyl)-N-(2-methyl-2-piperidin-1-ylpropyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55335688 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-(2-ethylphenyl)-N-(2-methyl-2-piperidin-1-ylpropyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1ccccc1N1CC(C(=O)NCC(C)(C)N2CCCCC2)CC1=O |
| InChI | InChI=1S/C22H33N3O2/c1-4-17-10-6-7-11-19(17)25-15-18(14-20(25)26)21(27)23-16-22(2,3)24-12-8-5-9-13-24/h6-7,10-11,18H,4-5,8-9,12-16H2,1-3H3,(H,23,27) |
| InChIKey | CBUDSHKRBFZPCM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |