C18H27ClIN3O3 — CID 111155851
ethyl 1-[N-[2-(3-chlorophenoxy)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111155851) has the molecular formula C18H27ClIN3O3 and a molecular weight of 495.79 g/mol. Its IUPAC name is ethyl 1-[N-[2-(3-chlorophenoxy)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[2-(3-chlorophenoxy)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111155851 |
| Molecular Formula | C18H27ClIN3O3 |
| Molecular Weight | 495.79 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | ethyl 1-[N-[2-(3-chlorophenoxy)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCOc2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C18H26ClN3O3.HI/c1-3-24-17(23)14-7-10-22(11-8-14)18(20-2)21-9-12-25-16-6-4-5-15(19)13-16;/h4-6,13-14H,3,7-12H2,1-2H3,(H,20,21);1H |
| InChIKey | JTFJDBHTASPGMS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|