C22H37IN4O4 — CID 111157301
ethyl 1-[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111157301) has the molecular formula C22H37IN4O4 and a molecular weight of 548.47 g/mol. Its IUPAC name is ethyl 1-[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111157301 |
| Molecular Formula | C22H37IN4O4 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | ethyl 1-[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N\C)NCC(c2ccc(OC)c(OC)c2)N(C)C)CC1.I |
| InChI | InChI=1S/C22H36N4O4.HI/c1-7-30-21(27)16-10-12-26(13-11-16)22(23-2)24-15-18(25(3)4)17-8-9-19(28-5)20(14-17)29-6;/h8-9,14,16,18H,7,10-13,15H2,1-6H3,(H,23,24);1H |
| InChIKey | APNGYJBUOOIDDX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|