C23H39N5O4 — CID 111730107
tert-butyl N-[1-[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730107) has the molecular formula C23H39N5O4 and a molecular weight of 449.60 g/mol. Its IUPAC name is tert-butyl N-[1-[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730107 |
| Molecular Formula | C23H39N5O4 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | tert-butyl N-[1-[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(/NCC(c1ccc(OC)c(OC)c1)N(C)C)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H39N5O4/c1-23(2,3)32-22(29)26-17-11-12-28(15-17)21(24-4)25-14-18(27(5)6)16-9-10-19(30-7)20(13-16)31-8/h9-10,13,17-18H,11-12,14-15H2,1-8H3,(H,24,25)(H,26,29) |
| InChIKey | SOCSWGYCPCBICA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|