C20H33N5O3 — CID 111164647
ethyl 4-[N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111164647) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is ethyl 4-[N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111164647 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | ethyl 4-[N-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCC(c2cccc(OC)c2)N(C)C)CC1 |
| InChI | InChI=1S/C20H33N5O3/c1-6-28-20(26)25-12-10-24(11-13-25)19(21-2)22-15-18(23(3)4)16-8-7-9-17(14-16)27-5/h7-9,14,18H,6,10-13,15H2,1-5H3,(H,21,22) |
| InChIKey | RQWWDAMJCQBBEC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|