C17H23IN4O2 — CID 56801547
2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(2-phenoxyethyl)-3-prop-2-enylguanidine;hydroiodide (PubChem CID 56801547) has the molecular formula C17H23IN4O2 and a molecular weight of 442.30 g/mol. Its IUPAC name is 2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(2-phenoxyethyl)-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(2-phenoxyethyl)-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 56801547 |
| Molecular Formula | C17H23IN4O2 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(2-phenoxyethyl)-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1cc(C)on1)NCCOc1ccccc1.I |
| InChI | InChI=1S/C17H22N4O2.HI/c1-3-9-18-17(20-13-15-12-14(2)23-21-15)19-10-11-22-16-7-5-4-6-8-16;/h3-8,12H,1,9-11,13H2,2H3,(H2,18,19,20);1H |
| InChIKey | YFKBMZCSYXFBFP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|