C21H25IN4O2 — CID 111277052
2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111277052) has the molecular formula C21H25IN4O2 and a molecular weight of 492.36 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111277052 |
| Molecular Formula | C21H25IN4O2 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc(C)cc1)NCc1cc(-c2ccccc2)on1.I |
| InChI | InChI=1S/C21H24N4O2.HI/c1-16-8-10-19(11-9-16)26-13-12-23-21(22-2)24-15-18-14-20(27-25-18)17-6-4-3-5-7-17;/h3-11,14H,12-13,15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | VRSBSISXQOJEAE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|