C17H20IN5OS — CID 111525031
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111525031) has the molecular formula C17H20IN5OS and a molecular weight of 469.35 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111525031 |
| Molecular Formula | C17H20IN5OS |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(-c2ccccc2)on1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C17H19N5OS.HI/c1-12-9-19-16(24-12)11-21-17(18-2)20-10-14-8-15(23-22-14)13-6-4-3-5-7-13;/h3-9H,10-11H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | NFNXHACHHZBQGZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|