C15H21IN4S — CID 111492533
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide (PubChem CID 111492533) has the molecular formula C15H21IN4S and a molecular weight of 416.33 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111492533 |
| Molecular Formula | C15H21IN4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C)s1)NC(C)c1ccccc1.I |
| InChI | InChI=1S/C15H20N4S.HI/c1-11-9-17-14(20-11)10-18-15(16-3)19-12(2)13-7-5-4-6-8-13;/h4-9,12H,10H2,1-3H3,(H2,16,18,19);1H |
| InChIKey | KERGKJLNMDVSEJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|