C16H30IN5O — CID 111965164
1-ethyl-3-[3-(4-methylpiperidin-1-yl)propyl]-2-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111965164) has the molecular formula C16H30IN5O and a molecular weight of 435.35 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-methylpiperidin-1-yl)propyl]-2-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-methylpiperidin-1-yl)propyl]-2-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111965164 |
| Molecular Formula | C16H30IN5O |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-ethyl-3-[3-(4-methylpiperidin-1-yl)propyl]-2-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccon1)NCCCN1CCC(C)CC1.I |
| InChI | InChI=1S/C16H29N5O.HI/c1-3-17-16(19-13-15-7-12-22-20-15)18-8-4-9-21-10-5-14(2)6-11-21;/h7,12,14H,3-6,8-11,13H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | DHIQOJRMAMIERA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|