C19H27FIN5 — CID 111361184
2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111361184) has the molecular formula C19H27FIN5 and a molecular weight of 471.36 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111361184 |
| Molecular Formula | C19H27FIN5 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N(C)C)c1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C19H26FN5.HI/c1-4-21-19(23-12-10-16-7-5-6-8-17(16)20)24-14-15-9-11-22-18(13-15)25(2)3;/h5-9,11,13H,4,10,12,14H2,1-3H3,(H2,21,23,24);1H |
| InChIKey | UVMZFZQWTCIXLY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|