C17H21F2N3S — CID 111566719
1-[2-(2,3-difluorophenyl)ethyl]-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111566719) has the molecular formula C17H21F2N3S and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-[2-(2,3-difluorophenyl)ethyl]-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(2,3-difluorophenyl)ethyl]-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111566719 |
| Molecular Formula | C17H21F2N3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[2-(2,3-difluorophenyl)ethyl]-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCCc1cccc(F)c1F |
| InChI | InChI=1S/C17H21F2N3S/c1-3-20-17(22-11-14-8-7-12(2)23-14)21-10-9-13-5-4-6-15(18)16(13)19/h4-8H,3,9-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | UWLLUAIDZJLHBS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|