C15H23F2IN4O — CID 111566788
2-[[[2-(2,3-difluorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111566788) has the molecular formula C15H23F2IN4O and a molecular weight of 440.28 g/mol. Its IUPAC name is 2-[[[2-(2,3-difluorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(2,3-difluorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111566788 |
| Molecular Formula | C15H23F2IN4O |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 2-[[[2-(2,3-difluorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCCc1cccc(F)c1F.I |
| InChI | InChI=1S/C15H22F2N4O.HI/c1-4-18-15(20-10-13(22)21(2)3)19-9-8-11-6-5-7-12(16)14(11)17;/h5-7H,4,8-10H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | AVHMJIKREIZTHY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|