C24H32F2N4O2 — CID 111991761
1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine (PubChem CID 111991761) has the molecular formula C24H32F2N4O2 and a molecular weight of 446.54 g/mol. Its IUPAC name is 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine.
| Compound Name | 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111991761 |
| Molecular Formula | C24H32F2N4O2 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)cc1)NC1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H32F2N4O2/c1-3-27-24(28-15-23(31)18-5-7-20(32-2)8-6-18)29-19-10-12-30(13-11-19)16-17-4-9-21(25)22(26)14-17/h4-9,14,19,23,31H,3,10-13,15-16H2,1-2H3,(H2,27,28,29) |
| InChIKey | TTZSLBORCCICLF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|