C18H33IN6O2S — CID 111519392
2-[4-[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111519392) has the molecular formula C18H33IN6O2S and a molecular weight of 524.47 g/mol. Its IUPAC name is 2-[4-[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[4-[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111519392 |
| Molecular Formula | C18H33IN6O2S |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-[4-[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)N1CCN(CC(=O)NCCOC)CC1.I |
| InChI | InChI=1S/C18H32N6O2S.HI/c1-4-15-12-21-17(27-15)13-22-18(19-5-2)24-9-7-23(8-10-24)14-16(25)20-6-11-26-3;/h12H,4-11,13-14H2,1-3H3,(H,19,22)(H,20,25);1H |
| InChIKey | WVDRKHNZEIGKQC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|