C22H39IN6OS — CID 111520646
4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111520646) has the molecular formula C22H39IN6OS and a molecular weight of 562.57 g/mol. Its IUPAC name is 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111520646 |
| Molecular Formula | C22H39IN6OS |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)N1CCN(CC(=O)N2CC(C)CC(C)C2)CC1.I |
| InChI | InChI=1S/C22H38N6OS.HI/c1-5-19-12-24-20(30-19)13-25-22(23-6-2)27-9-7-26(8-10-27)16-21(29)28-14-17(3)11-18(4)15-28;/h12,17-18H,5-11,13-16H2,1-4H3,(H,23,25);1H |
| InChIKey | HZKMVSLQHZFDLV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|