C18H34IN5S — CID 111516146
N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-4-(2-methylpropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111516146) has the molecular formula C18H34IN5S and a molecular weight of 479.48 g/mol. Its IUPAC name is N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-4-(2-methylpropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-4-(2-methylpropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111516146 |
| Molecular Formula | C18H34IN5S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-4-(2-methylpropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ncc(CC)s1)N1CCN(CC(C)C)CC1.I |
| InChI | InChI=1S/C18H33N5S.HI/c1-5-16-13-21-17(24-16)7-8-20-18(19-6-2)23-11-9-22(10-12-23)14-15(3)4;/h13,15H,5-12,14H2,1-4H3,(H,19,20);1H |
| InChIKey | VXZUELBYWGMOQO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|