C18H31IN4OS — CID 119157407
N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide (PubChem CID 119157407) has the molecular formula C18H31IN4OS and a molecular weight of 478.44 g/mol. Its IUPAC name is N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119157407 |
| Molecular Formula | C18H31IN4OS |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ncc(CC)s1)N1CCC2(CCOCC2)C1.I |
| InChI | InChI=1S/C18H30N4OS.HI/c1-3-15-13-21-16(24-15)5-9-20-17(19-4-2)22-10-6-18(14-22)7-11-23-12-8-18;/h13H,3-12,14H2,1-2H3,(H,19,20);1H |
| InChIKey | ZEUDYCXMVINWOS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|