C16H28IN3OS — CID 119160819
N-ethyl-N'-(2-prop-2-ynylsulfanylethyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide (PubChem CID 119160819) has the molecular formula C16H28IN3OS and a molecular weight of 437.39 g/mol. Its IUPAC name is N-ethyl-N'-(2-prop-2-ynylsulfanylethyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-prop-2-ynylsulfanylethyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119160819 |
| Molecular Formula | C16H28IN3OS |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-ethyl-N'-(2-prop-2-ynylsulfanylethyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
| SMILES | C#CCSCC/N=C(\NCC)N1CCC2(CCOCC2)C1.I |
| InChI | InChI=1S/C16H27N3OS.HI/c1-3-12-21-13-8-18-15(17-4-2)19-9-5-16(14-19)6-10-20-11-7-16;/h1H,4-14H2,2H3,(H,17,18);1H |
| InChIKey | HHMJTJSYGMJGJS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|