C17H26F3IN4OS — CID 119157395
N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide (PubChem CID 119157395) has the molecular formula C17H26F3IN4OS and a molecular weight of 518.39 g/mol. Its IUPAC name is N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119157395 |
| Molecular Formula | C17H26F3IN4OS |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | N-ethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)N1CCC2(CCOCC2)C1.I |
| InChI | InChI=1S/C17H25F3N4OS.HI/c1-2-21-15(24-8-4-16(12-24)5-9-25-10-6-16)22-7-3-14-23-13(11-26-14)17(18,19)20;/h11H,2-10,12H2,1H3,(H,21,22);1H |
| InChIKey | KCQLXJLIKBYAGM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|