C14H24F3N3O2 — CID 119154372
N-ethyl-N'-(3,3,3-trifluoro-2-hydroxypropyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 119154372) has the molecular formula C14H24F3N3O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-ethyl-N'-(3,3,3-trifluoro-2-hydroxypropyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N-ethyl-N'-(3,3,3-trifluoro-2-hydroxypropyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 119154372 |
| Molecular Formula | C14H24F3N3O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-ethyl-N'-(3,3,3-trifluoro-2-hydroxypropyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | CCN/C(=N\CC(O)C(F)(F)F)N1CCC2(CCOCC2)C1 |
| InChI | InChI=1S/C14H24F3N3O2/c1-2-18-12(19-9-11(21)14(15,16)17)20-6-3-13(10-20)4-7-22-8-5-13/h11,21H,2-10H2,1H3,(H,18,19) |
| InChIKey | ZASGNSKJLKTCMO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|