C12H18F3IN4S — CID 111478527
N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111478527) has the molecular formula C12H18F3IN4S and a molecular weight of 434.27 g/mol. Its IUPAC name is N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111478527 |
| Molecular Formula | C12H18F3IN4S |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCc1nc(C(F)(F)F)cs1)N1CCCC1.I |
| InChI | InChI=1S/C12H17F3N4S.HI/c1-16-11(19-6-2-3-7-19)17-5-4-10-18-9(8-20-10)12(13,14)15;/h8H,2-7H2,1H3,(H,16,17);1H |
| InChIKey | CDCUNGAFPAGYBB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|