C15H28IN5S — CID 111516142
N'-methyl-4-(2-methylpropyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111516142) has the molecular formula C15H28IN5S and a molecular weight of 437.40 g/mol. Its IUPAC name is N'-methyl-4-(2-methylpropyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(2-methylpropyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111516142 |
| Molecular Formula | C15H28IN5S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N'-methyl-4-(2-methylpropyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C)s1)N1CCN(CC(C)C)CC1.I |
| InChI | InChI=1S/C15H27N5S.HI/c1-12(2)11-19-5-7-20(8-6-19)15(16-4)18-10-14-17-9-13(3)21-14;/h9,12H,5-8,10-11H2,1-4H3,(H,16,18);1H |
| InChIKey | IVMLPGLQXRASHO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|