C15H18N4S — CID 111495398
N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 111495398) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 111495398 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | C/N=C(\NCc1ncc(C)s1)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H18N4S/c1-11-9-17-14(20-11)10-18-15(16-2)19-8-7-12-5-3-4-6-13(12)19/h3-6,9H,7-8,10H2,1-2H3,(H,16,18) |
| InChIKey | LGPCBNKMGJUJHD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|