C20H21N5 — CID 110985056
N'-methyl-N-[(5-phenyl-1H-imidazol-2-yl)methyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 110985056) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is N'-methyl-N-[(5-phenyl-1H-imidazol-2-yl)methyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-methyl-N-[(5-phenyl-1H-imidazol-2-yl)methyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110985056 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N'-methyl-N-[(5-phenyl-1H-imidazol-2-yl)methyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | C/N=C(\NCc1ncc(-c2ccccc2)[nH]1)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H21N5/c1-21-20(25-12-11-16-9-5-6-10-18(16)25)23-14-19-22-13-17(24-19)15-7-3-2-4-8-15/h2-10,13H,11-12,14H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | QWYNYDYOZAFRQM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|