C17H22ClN5S — CID 111511825
4-(3-chlorophenyl)-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111511825) has the molecular formula C17H22ClN5S and a molecular weight of 363.92 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-chlorophenyl)-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111511825 |
| Molecular Formula | C17H22ClN5S |
| Molecular Weight | 363.92 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ncc(C)s1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H22ClN5S/c1-13-11-20-16(24-13)12-21-17(19-2)23-8-6-22(7-9-23)15-5-3-4-14(18)10-15/h3-5,10-11H,6-9,12H2,1-2H3,(H,19,21) |
| InChIKey | JQTVERATFDSOSS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.92 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|