C18H25ClIN5O — CID 111186736
4-(3-chlorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111186736) has the molecular formula C18H25ClIN5O and a molecular weight of 489.79 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186736 |
| Molecular Formula | C18H25ClIN5O |
| Molecular Weight | 489.79 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 4-(3-chlorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C18H24ClN5O.HI/c1-13-14(2)25-17(22-13)12-21-18(20-3)24-9-7-23(8-10-24)16-6-4-5-15(19)11-16;/h4-6,11H,7-10,12H2,1-3H3,(H,20,21);1H |
| InChIKey | YBMMIELOJXDNKP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|