C18H25ClIN5S — CID 111186840
4-(3-chlorophenyl)-N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111186840) has the molecular formula C18H25ClIN5S and a molecular weight of 505.86 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186840 |
| Molecular Formula | C18H25ClIN5S |
| Molecular Weight | 505.86 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(C)n1)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C18H24ClN5S.HI/c1-14-22-16(13-25-14)6-7-21-18(20-2)24-10-8-23(9-11-24)17-5-3-4-15(19)12-17;/h3-5,12-13H,6-11H2,1-2H3,(H,20,21);1H |
| InChIKey | WRSNGLOFVREUEF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|