C20H29N5S — CID 111238443
4-(2,3-dimethylphenyl)-N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111238443) has the molecular formula C20H29N5S and a molecular weight of 371.55 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,3-dimethylphenyl)-N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111238443 |
| Molecular Formula | C20H29N5S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1csc(C)n1)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C20H29N5S/c1-15-6-5-7-19(16(15)2)24-10-12-25(13-11-24)20(21-4)22-9-8-18-14-26-17(3)23-18/h5-7,14H,8-13H2,1-4H3,(H,21,22) |
| InChIKey | OVUCWAHYLSHKJU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|