C20H29N5O2S — CID 111514878
4-[(2,5-dimethoxyphenyl)methyl]-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111514878) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111514878 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ncc(C)s1)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C20H29N5O2S/c1-15-12-22-19(28-15)13-23-20(21-2)25-9-7-24(8-10-25)14-16-11-17(26-3)5-6-18(16)27-4/h5-6,11-12H,7-10,13-14H2,1-4H3,(H,21,23) |
| InChIKey | JAUXUXPMXLIWED-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|