C24H32IN5O2 — CID 111303194
4-[(2,5-dimethoxyphenyl)methyl]-N-(1H-indol-2-ylmethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111303194) has the molecular formula C24H32IN5O2 and a molecular weight of 549.46 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-(1H-indol-2-ylmethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-(1H-indol-2-ylmethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111303194 |
| Molecular Formula | C24H32IN5O2 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-(1H-indol-2-ylmethyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1cc2ccccc2[nH]1)N1CCN(Cc2cc(OC)ccc2OC)CC1.I |
| InChI | InChI=1S/C24H31N5O2.HI/c1-25-24(26-16-20-14-18-6-4-5-7-22(18)27-20)29-12-10-28(11-13-29)17-19-15-21(30-2)8-9-23(19)31-3;/h4-9,14-15,27H,10-13,16-17H2,1-3H3,(H,25,26);1H |
| InChIKey | LYSIOTFNPFBSKS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|